C10H13N — CID 142493166
N-(6-ethenyl-4-methylcyclohexa-1,5-dien-1-yl)methanimine (PubChem CID 142493166) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is N-(6-ethenyl-4-methylcyclohexa-1,5-dien-1-yl)methanimine.
| Compound Name | N-(6-ethenyl-4-methylcyclohexa-1,5-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 142493166 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | N-(6-ethenyl-4-methylcyclohexa-1,5-dien-1-yl)methanimine |
| SMILES | C=CC1=CC(C)CC=C1N=C |
| InChI | InChI=1S/C10H13N/c1-4-9-7-8(2)5-6-10(9)11-3/h4,6-8H,1,3,5H2,2H3 |
| InChIKey | GNULMVWTXRHWBX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|