C11H10BrNO — CID 175747149
(4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-1,3-oxazole (PubChem CID 175747149) has the molecular formula C11H10BrNO and a molecular weight of 252.11 g/mol. Its IUPAC name is (4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-1,3-oxazole.
| Compound Name | (4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-1,3-oxazole |
|---|---|
| PubChem CID | 175747149 |
| Molecular Formula | C11H10BrNO |
| Molecular Weight | 252.11 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | (4Z)-4-[(4-bromophenyl)methylidene]-2-methyl-1,3-oxazole |
| SMILES | CC1=N/C(=C\c2ccc(Br)cc2)CO1 |
| InChI | InChI=1S/C11H10BrNO/c1-8-13-11(7-14-8)6-9-2-4-10(12)5-3-9/h2-6H,7H2,1H3/b11-6- |
| InChIKey | LXQURQNRYYFRQZ-WDZFZDKYSA-N |
| XLogP | 3.24 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.11 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |