About O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate
O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate (PubChem CID 175747241) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate.
Molecular Properties
| Compound Name | O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate |
| PubChem CID | 175747241 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate |
| SMILES | C=CCN(C(=S)OCC)C(C)C |
| InChI | InChI=1S/C9H17NOS/c1-5-7-10(8(3)4)9(12)11-6-2/h5,8H,1,6-7H2,2-4H3 |
| InChIKey | WKLAXCSKEIJAJQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate?
The IUPAC name of O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate (CID 175747241) is O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate.
What is the SMILES notation for O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate?
The canonical SMILES for O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate is C=CCN(C(=S)OCC)C(C)C.
What is the InChIKey of O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate?
The InChIKey is WKLAXCSKEIJAJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NOS/c1-5-7-10(8(3)4)9(12)11-6-2/h5,8H,1,6-7H2,2-4H3.
What are the key properties of O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate?
O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate has a molecular weight of 187.31 g/mol, XLogP of 2.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl N-propan-2-yl-N-prop-2-enylcarbamothioate is sourced from PubChem (CID 175747241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).