C19H20ClN7O5 — CID 175750722
7-chloro-N-[2-[(6-methoxy-5-nitro-3-pyridinyl)methoxy]propyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide (PubChem CID 175750722) has the molecular formula C19H20ClN7O5 and a molecular weight of 461.87 g/mol. Its IUPAC name is 7-chloro-N-[2-[(6-methoxy-5-nitro-3-pyridinyl)methoxy]propyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide.
| Compound Name | 7-chloro-N-[2-[(6-methoxy-5-nitro-3-pyridinyl)methoxy]propyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide |
|---|---|
| PubChem CID | 175750722 |
| Molecular Formula | C19H20ClN7O5 |
| Molecular Weight | 461.87 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | 7-chloro-N-[2-[(6-methoxy-5-nitro-3-pyridinyl)methoxy]propyl]-1,3,8,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene-10-carboxamide |
| SMILES | COc1ncc(COC(C)CNC(=O)c2cnn3c4c(c(Cl)nc23)CCN4)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H20ClN7O5/c1-10(32-9-11-5-14(27(29)30)19(31-2)23-7-11)6-22-18(28)13-8-24-26-16-12(3-4-21-16)15(20)25-17(13)26/h5,7-8,10,21H,3-4,6,9H2,1-2H3,(H,22,28) |
| InChIKey | KLBPAAUYZGMNCN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.87 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|