C11H13NO4 — CID 175758604
2-oxo-1-[3-(trideuteriomethoxy)cyclobutyl]pyridine-3-carboxylic acid (PubChem CID 175758604) has the molecular formula C11H13NO4 and a molecular weight of 226.25 g/mol. Its IUPAC name is 2-oxo-1-[3-(trideuteriomethoxy)cyclobutyl]pyridine-3-carboxylic acid.
| Compound Name | 2-oxo-1-[3-(trideuteriomethoxy)cyclobutyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 175758604 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-oxo-1-[3-(trideuteriomethoxy)cyclobutyl]pyridine-3-carboxylic acid |
| SMILES | [2H]C([2H])([2H])OC1CC(n2cccc(C(=O)O)c2=O)C1 |
| InChI | InChI=1S/C11H13NO4/c1-16-8-5-7(6-8)12-4-2-3-9(10(12)13)11(14)15/h2-4,7-8H,5-6H2,1H3,(H,14,15)/i1D3 |
| InChIKey | NICQEAYZTDNWHV-FIBGUPNXSA-N |
| XLogP | 0.90 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |