C26H24FNO4S — CID 175761517
[3-[4-[2-(ethylamino)ethoxy]phenoxy]-6-methoxy-1-benzothiophen-2-yl]-(3-fluorophenyl)methanone (PubChem CID 175761517) has the molecular formula C26H24FNO4S and a molecular weight of 465.55 g/mol. Its IUPAC name is [3-[4-[2-(ethylamino)ethoxy]phenoxy]-6-methoxy-1-benzothiophen-2-yl]-(3-fluorophenyl)methanone.
| Compound Name | [3-[4-[2-(ethylamino)ethoxy]phenoxy]-6-methoxy-1-benzothiophen-2-yl]-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 175761517 |
| Molecular Formula | C26H24FNO4S |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | [3-[4-[2-(ethylamino)ethoxy]phenoxy]-6-methoxy-1-benzothiophen-2-yl]-(3-fluorophenyl)methanone |
| SMILES | CCNCCOc1ccc(Oc2c(C(=O)c3cccc(F)c3)sc3cc(OC)ccc23)cc1 |
| InChI | InChI=1S/C26H24FNO4S/c1-3-28-13-14-31-19-7-9-20(10-8-19)32-25-22-12-11-21(30-2)16-23(22)33-26(25)24(29)17-5-4-6-18(27)15-17/h4-12,15-16,28H,3,13-14H2,1-2H3 |
| InChIKey | OTXHXJJZHNADHR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|