C5H7NO3 — CID 175764758
(1-deuterio-4-oxoazetidin-2-yl) acetate (PubChem CID 175764758) has the molecular formula C5H7NO3 and a molecular weight of 130.12 g/mol. Its IUPAC name is (1-deuterio-4-oxoazetidin-2-yl) acetate.
| Compound Name | (1-deuterio-4-oxoazetidin-2-yl) acetate |
|---|---|
| PubChem CID | 175764758 |
| Molecular Formula | C5H7NO3 |
| Molecular Weight | 130.12 g/mol |
| Exact Mass | 130.05 |
| IUPAC Name | (1-deuterio-4-oxoazetidin-2-yl) acetate |
| SMILES | [2H]N1C(=O)CC1OC(C)=O |
| InChI | InChI=1S/C5H7NO3/c1-3(7)9-5-2-4(8)6-5/h5H,2H2,1H3,(H,6,8)/i/hD |
| InChIKey | OEYMQQDJCUHKQS-DYCDLGHISA-N |
| XLogP | -0.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.12 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |