C33H34O9 — CID 175767804
2-phenyl-4-(6-prop-2-enoyloxyhexoxy)-3-(4-propoxycarbonylphenoxy)carbonylbenzoic acid (PubChem CID 175767804) has the molecular formula C33H34O9 and a molecular weight of 574.63 g/mol. Its IUPAC name is 2-phenyl-4-(6-prop-2-enoyloxyhexoxy)-3-(4-propoxycarbonylphenoxy)carbonylbenzoic acid.
| Compound Name | 2-phenyl-4-(6-prop-2-enoyloxyhexoxy)-3-(4-propoxycarbonylphenoxy)carbonylbenzoic acid |
|---|---|
| PubChem CID | 175767804 |
| Molecular Formula | C33H34O9 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 2-phenyl-4-(6-prop-2-enoyloxyhexoxy)-3-(4-propoxycarbonylphenoxy)carbonylbenzoic acid |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)O)c(-c2ccccc2)c1C(=O)Oc1ccc(C(=O)OCCC)cc1 |
| InChI | InChI=1S/C33H34O9/c1-3-20-41-32(37)24-14-16-25(17-15-24)42-33(38)30-27(39-21-10-5-6-11-22-40-28(34)4-2)19-18-26(31(35)36)29(30)23-12-8-7-9-13-23/h4,7-9,12-19H,2-3,5-6,10-11,20-22H2,1H3,(H,35,36) |
| InChIKey | LHEHJHYHCXMEBI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|