C38H64N4O5 — CID 175772367
8-[3-[[(cyanoamino)-phenoxymethylidene]amino]propyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid (PubChem CID 175772367) has the molecular formula C38H64N4O5 and a molecular weight of 656.95 g/mol. Its IUPAC name is 8-[3-[[(cyanoamino)-phenoxymethylidene]amino]propyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid.
| Compound Name | 8-[3-[[(cyanoamino)-phenoxymethylidene]amino]propyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid |
|---|---|
| PubChem CID | 175772367 |
| Molecular Formula | C38H64N4O5 |
| Molecular Weight | 656.95 g/mol |
| Exact Mass | 656.49 |
| IUPAC Name | 8-[3-[[(cyanoamino)-phenoxymethylidene]amino]propyl-(8-oxo-8-undecan-3-yloxyoctyl)amino]octanoic acid |
| SMILES | CCCCCCCCC(CC)OC(=O)CCCCCCCN(CCCCCCCC(=O)O)CCC/N=C(\NC#N)Oc1ccccc1 |
| InChI | InChI=1S/C38H64N4O5/c1-3-5-6-7-10-16-24-34(4-2)46-37(45)28-20-12-9-14-22-31-42(30-21-13-8-11-19-27-36(43)44)32-23-29-40-38(41-33-39)47-35-25-17-15-18-26-35/h15,17-18,25-26,34H,3-14,16,19-24,27-32H2,1-2H3,(H,40,41)(H,43,44) |
| InChIKey | KGDKFIFDIMSWBM-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 124.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.95 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|