C13H13N3O — CID 175773827
2-(1H-pyrrol-3-yl)-2,3-dihydroindole-1-carboxamide (PubChem CID 175773827) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-(1H-pyrrol-3-yl)-2,3-dihydroindole-1-carboxamide.
| Compound Name | 2-(1H-pyrrol-3-yl)-2,3-dihydroindole-1-carboxamide |
|---|---|
| PubChem CID | 175773827 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-(1H-pyrrol-3-yl)-2,3-dihydroindole-1-carboxamide |
| SMILES | NC(=O)N1c2ccccc2CC1c1cc[nH]c1 |
| InChI | InChI=1S/C13H13N3O/c14-13(17)16-11-4-2-1-3-9(11)7-12(16)10-5-6-15-8-10/h1-6,8,12,15H,7H2,(H2,14,17) |
| InChIKey | YRUIRENGAHMBHV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |