C9H8FN3O — CID 175774512
8-(2-fluoroethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 175774512) has the molecular formula C9H8FN3O and a molecular weight of 193.18 g/mol. Its IUPAC name is 8-(2-fluoroethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(2-fluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 175774512 |
| Molecular Formula | C9H8FN3O |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 8-(2-fluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cncnc2n1CCF |
| InChI | InChI=1S/C9H8FN3O/c10-3-4-13-8(14)2-1-7-5-11-6-12-9(7)13/h1-2,5-6H,3-4H2 |
| InChIKey | NGALPRQRVQZDKV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |