C16H21N3O5 — CID 175787570
deuterio-[(2S,3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-(4-nitrophenyl)oxiran-2-yl]methanone (PubChem CID 175787570) has the molecular formula C16H21N3O5 and a molecular weight of 336.37 g/mol. Its IUPAC name is deuterio-[(2S,3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-(4-nitrophenyl)oxiran-2-yl]methanone.
| Compound Name | deuterio-[(2S,3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-(4-nitrophenyl)oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 175787570 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | deuterio-[(2S,3R)-3-[4-(2-hydroxyethyl)piperazin-1-yl]-2-methyl-3-(4-nitrophenyl)oxiran-2-yl]methanone |
| SMILES | [2H]C(=O)[C@@]1(C)O[C@@]1(c1ccc([N+](=O)[O-])cc1)N1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H21N3O5/c1-15(12-21)16(24-15,13-2-4-14(5-3-13)19(22)23)18-8-6-17(7-9-18)10-11-20/h2-5,12,20H,6-11H2,1H3/t15-,16-/m1/s1/i12D |
| InChIKey | WAAZSYJGZPSFQH-IUVXGORCSA-N |
| XLogP | 0.35 |
| TPSA | 99.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|