C9H13NO2 — CID 175821443
2,4,6-trimethyl-2H-pyridine-1-carboxylic acid (PubChem CID 175821443) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2,4,6-trimethyl-2H-pyridine-1-carboxylic acid.
| Compound Name | 2,4,6-trimethyl-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 175821443 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2,4,6-trimethyl-2H-pyridine-1-carboxylic acid |
| SMILES | CC1=CC(C)N(C(=O)O)C(C)=C1 |
| InChI | InChI=1S/C9H13NO2/c1-6-4-7(2)10(9(11)12)8(3)5-6/h4-5,7H,1-3H3,(H,11,12) |
| InChIKey | SQXSWWXMSDNXOC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |