C22H30N6O14P2 — CID 175829492
[(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[[(1R)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methoxy]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 175829492) has the molecular formula C22H30N6O14P2 and a molecular weight of 664.46 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[[(1R)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methoxy]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[[(1R)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methoxy]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 175829492 |
| Molecular Formula | C22H30N6O14P2 |
| Molecular Weight | 664.46 g/mol |
| Exact Mass | 664.13 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-4-[[(1R)-2,2-dimethyl-1-(2-nitrophenyl)propoxy]methoxy]-3-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | CC(C)(C)[C@@H](OCO[C@@H]1[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)O)O[C@H]1n1cnc2c(=O)[nH]c(N)nc21)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H30N6O14P2/c1-22(2,3)17(11-6-4-5-7-12(11)28(31)32)39-10-38-16-15(29)13(8-40-44(36,37)42-43(33,34)35)41-20(16)27-9-24-14-18(27)25-21(23)26-19(14)30/h4-7,9,13,15-17,20,29H,8,10H2,1-3H3,(H,36,37)(H2,33,34,35)(H3,23,25,26,30)/t13-,15-,16-,17+,20-/m1/s1 |
| InChIKey | DMFHSLJTPGWURN-ZHKLBRLOSA-N |
| XLogP | 1.24 |
| TPSA | 293.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|