C28H32O7S3 — CID 175847082
10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]decanoic acid (PubChem CID 175847082) has the molecular formula C28H32O7S3 and a molecular weight of 576.76 g/mol. Its IUPAC name is 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]decanoic acid.
| Compound Name | 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]decanoic acid |
|---|---|
| PubChem CID | 175847082 |
| Molecular Formula | C28H32O7S3 |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.13 |
| IUPAC Name | 10-(4,5-dimethoxy-2-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl)-2-[4-(5-sulfanylidenedithiol-3-yl)phenoxy]decanoic acid |
| SMILES | COC1=C(OC)C(=O)C(CCCCCCCCC(Oc2ccc(-c3cc(=S)ss3)cc2)C(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C28H32O7S3/c1-17-20(25(30)27(34-3)26(33-2)24(17)29)10-8-6-4-5-7-9-11-21(28(31)32)35-19-14-12-18(13-15-19)22-16-23(36)38-37-22/h12-16,21H,4-11H2,1-3H3,(H,31,32) |
| InChIKey | RNRSATIFSBHIKL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|