C22H40O4S — CID 175848595
4,4-bis(2-ethylhexoxymethyl)-6,7-dioxa-3-thiabicyclo[3.2.0]hept-1-ene (PubChem CID 175848595) has the molecular formula C22H40O4S and a molecular weight of 400.63 g/mol. Its IUPAC name is 4,4-bis(2-ethylhexoxymethyl)-6,7-dioxa-3-thiabicyclo[3.2.0]hept-1-ene.
| Compound Name | 4,4-bis(2-ethylhexoxymethyl)-6,7-dioxa-3-thiabicyclo[3.2.0]hept-1-ene |
|---|---|
| PubChem CID | 175848595 |
| Molecular Formula | C22H40O4S |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 4,4-bis(2-ethylhexoxymethyl)-6,7-dioxa-3-thiabicyclo[3.2.0]hept-1-ene |
| SMILES | CCCCC(CC)COCC1(COCC(CC)CCCC)SC=C2OOC21 |
| InChI | InChI=1S/C22H40O4S/c1-5-9-11-18(7-3)13-23-16-22(21-20(15-27-22)25-26-21)17-24-14-19(8-4)12-10-6-2/h15,18-19,21H,5-14,16-17H2,1-4H3 |
| InChIKey | GDWRZFKXZJCIOP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|