C17H34O2 — CID 58640621
2-(2-ethylhexoxymethyl)-2,3,3,4,4-pentamethyloxetane (PubChem CID 58640621) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 2-(2-ethylhexoxymethyl)-2,3,3,4,4-pentamethyloxetane.
| Compound Name | 2-(2-ethylhexoxymethyl)-2,3,3,4,4-pentamethyloxetane |
|---|---|
| PubChem CID | 58640621 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 2-(2-ethylhexoxymethyl)-2,3,3,4,4-pentamethyloxetane |
| SMILES | CCCCC(CC)COCC1(C)OC(C)(C)C1(C)C |
| InChI | InChI=1S/C17H34O2/c1-8-10-11-14(9-2)12-18-13-17(7)15(3,4)16(5,6)19-17/h14H,8-13H2,1-7H3 |
| InChIKey | HRKAHRWHQYAVNT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |