C14H11FN2 — CID 175852111
6-fluoro-1,2,3,5-tetrahydropyrrolo[3,2-b]carbazole (PubChem CID 175852111) has the molecular formula C14H11FN2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 6-fluoro-1,2,3,5-tetrahydropyrrolo[3,2-b]carbazole.
| Compound Name | 6-fluoro-1,2,3,5-tetrahydropyrrolo[3,2-b]carbazole |
|---|---|
| PubChem CID | 175852111 |
| Molecular Formula | C14H11FN2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 6-fluoro-1,2,3,5-tetrahydropyrrolo[3,2-b]carbazole |
| SMILES | FC1=CC=C2N=c3cc4c(cc3=C2C1)NCC4 |
| InChI | InChI=1S/C14H11FN2/c15-9-1-2-12-10(6-9)11-7-13-8(3-4-16-13)5-14(11)17-12/h1-2,5,7,16H,3-4,6H2 |
| InChIKey | GVMDVKLAHWANJS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |