C17H21N3O3 — CID 175862285
3-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-1-methyl-2-oxopiperidine-3-carboxamide (PubChem CID 175862285) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is 3-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-1-methyl-2-oxopiperidine-3-carboxamide.
| Compound Name | 3-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-1-methyl-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 175862285 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 3-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-1-methyl-2-oxopiperidine-3-carboxamide |
| SMILES | CN1CCCC(CCc2c[nH]c3ccc(O)cc23)(C(N)=O)C1=O |
| InChI | InChI=1S/C17H21N3O3/c1-20-8-2-6-17(15(18)22,16(20)23)7-5-11-10-19-14-4-3-12(21)9-13(11)14/h3-4,9-10,19,21H,2,5-8H2,1H3,(H2,18,22) |
| InChIKey | JPUNGYRRGVBINY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|