C24H23FN6O — CID 175868447
[4-deuterio-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-(4-fluorophenyl)methanone (PubChem CID 175868447) has the molecular formula C24H23FN6O and a molecular weight of 431.49 g/mol. Its IUPAC name is [4-deuterio-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4-deuterio-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 175868447 |
| Molecular Formula | C24H23FN6O |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | [4-deuterio-2-[4-(4-methylpiperazin-1-yl)anilino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]-(4-fluorophenyl)methanone |
| SMILES | [2H]c1nc(Nc2ccc(N3CCN(C)CC3)cc2)nc2[nH]cc(C(=O)c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C24H23FN6O/c1-30-10-12-31(13-11-30)19-8-6-18(7-9-19)28-24-27-15-21-20(14-26-23(21)29-24)22(32)16-2-4-17(25)5-3-16/h2-9,14-15H,10-13H2,1H3,(H2,26,27,28,29)/i15D |
| InChIKey | IODBGGCCXAJAID-RWFJLFJASA-N |
| XLogP | 3.82 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|