C11H13F2N3O2 — CID 175874280
2-[[4-(difluoromethoxy)phenyl]hydrazinylidene]butanamide (PubChem CID 175874280) has the molecular formula C11H13F2N3O2 and a molecular weight of 257.24 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]hydrazinylidene]butanamide.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 175874280 |
| Molecular Formula | C11H13F2N3O2 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]hydrazinylidene]butanamide |
| SMILES | CCC(=NNc1ccc(OC(F)F)cc1)C(N)=O |
| InChI | InChI=1S/C11H13F2N3O2/c1-2-9(10(14)17)16-15-7-3-5-8(6-4-7)18-11(12)13/h3-6,11,15H,2H2,1H3,(H2,14,17) |
| InChIKey | VWDXQTUTCNIQRY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|