C4H7FO3 — CID 175877515
5-fluoro-5-methyl-1,3-dioxolan-4-ol (PubChem CID 175877515) has the molecular formula C4H7FO3 and a molecular weight of 122.09 g/mol. Its IUPAC name is 5-fluoro-5-methyl-1,3-dioxolan-4-ol.
| Compound Name | 5-fluoro-5-methyl-1,3-dioxolan-4-ol |
|---|---|
| PubChem CID | 175877515 |
| Molecular Formula | C4H7FO3 |
| Molecular Weight | 122.09 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | 5-fluoro-5-methyl-1,3-dioxolan-4-ol |
| SMILES | CC1(F)OCOC1O |
| InChI | InChI=1S/C4H7FO3/c1-4(5)3(6)7-2-8-4/h3,6H,2H2,1H3 |
| InChIKey | POQLQDOUZHCRPJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.09 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |