C22H19Cl2N3O3 — CID 175880093
3-chloro-2-[[6-chloro-3-(4-hydroxyiminocyclohexyl)quinolin-4-yl]amino]benzoic acid (PubChem CID 175880093) has the molecular formula C22H19Cl2N3O3 and a molecular weight of 444.32 g/mol. Its IUPAC name is 3-chloro-2-[[6-chloro-3-(4-hydroxyiminocyclohexyl)quinolin-4-yl]amino]benzoic acid.
| Compound Name | 3-chloro-2-[[6-chloro-3-(4-hydroxyiminocyclohexyl)quinolin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 175880093 |
| Molecular Formula | C22H19Cl2N3O3 |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-chloro-2-[[6-chloro-3-(4-hydroxyiminocyclohexyl)quinolin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1cccc(Cl)c1Nc1c(C2CCC(=NO)CC2)cnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H19Cl2N3O3/c23-13-6-9-19-16(10-13)20(26-21-15(22(28)29)2-1-3-18(21)24)17(11-25-19)12-4-7-14(27-30)8-5-12/h1-3,6,9-12,30H,4-5,7-8H2,(H,25,26)(H,28,29)/b27-14- |
| InChIKey | OFVXQSFVEIEYLV-VYYCAZPPSA-N |
| XLogP | 6.47 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|