C18H16F3NO3S — CID 175880971
N-benzylsulfonyl-2-methyl-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 175880971) has the molecular formula C18H16F3NO3S and a molecular weight of 383.39 g/mol. Its IUPAC name is N-benzylsulfonyl-2-methyl-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-benzylsulfonyl-2-methyl-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 175880971 |
| Molecular Formula | C18H16F3NO3S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-benzylsulfonyl-2-methyl-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=C(C)C(=O)N(c1cccc(C(F)(F)F)c1)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H16F3NO3S/c1-13(2)17(23)22(16-10-6-9-15(11-16)18(19,20)21)26(24,25)12-14-7-4-3-5-8-14/h3-11H,1,12H2,2H3 |
| InChIKey | JGSWUAZFNNFMKB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|