C9H11N5O3 — CID 175883401
1-[(2R,4S)-4-azidooxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 175883401) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is 1-[(2R,4S)-4-azidooxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S)-4-azidooxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175883401 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-[(2R,4S)-4-azidooxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])CO2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H11N5O3/c1-5-3-14(9(16)11-8(5)15)7-2-6(4-17-7)12-13-10/h3,6-7H,2,4H2,1H3,(H,11,15,16)/t6-,7+/m0/s1 |
| InChIKey | HEIKVBOZILWQPE-NKWVEPMBSA-N |
| XLogP | 0.44 |
| TPSA | 112.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|