C16H22N6O3 — CID 175886045
1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methyl-2-nitro-3-pyrimidin-2-ylbenzene-1,4-diamine (PubChem CID 175886045) has the molecular formula C16H22N6O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methyl-2-nitro-3-pyrimidin-2-ylbenzene-1,4-diamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methyl-2-nitro-3-pyrimidin-2-ylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 175886045 |
| Molecular Formula | C16H22N6O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-5-methoxy-1-N-methyl-2-nitro-3-pyrimidin-2-ylbenzene-1,4-diamine |
| SMILES | COc1cc(N(C)CCN(C)C)c([N+](=O)[O-])c(-c2ncccn2)c1N |
| InChI | InChI=1S/C16H22N6O3/c1-20(2)8-9-21(3)11-10-12(25-4)14(17)13(15(11)22(23)24)16-18-6-5-7-19-16/h5-7,10H,8-9,17H2,1-4H3 |
| InChIKey | PXZNIRJGPVCBQB-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 110.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|