C10H16N2 — CID 175887581
4-(azetidin-1-ylmethyl)-2-methyl-1,2-dihydropyridine (PubChem CID 175887581) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 4-(azetidin-1-ylmethyl)-2-methyl-1,2-dihydropyridine.
| Compound Name | 4-(azetidin-1-ylmethyl)-2-methyl-1,2-dihydropyridine |
|---|---|
| PubChem CID | 175887581 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 4-(azetidin-1-ylmethyl)-2-methyl-1,2-dihydropyridine |
| SMILES | CC1C=C(CN2CCC2)C=CN1 |
| InChI | InChI=1S/C10H16N2/c1-9-7-10(3-4-11-9)8-12-5-2-6-12/h3-4,7,9,11H,2,5-6,8H2,1H3 |
| InChIKey | COCYJFIJQLLLBQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |