C72H100BF20N — CID 175892491
8,8-dioctylhexadecyl(dioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 175892491) has the molecular formula C72H100BF20N and a molecular weight of 1370.37 g/mol. Its IUPAC name is 8,8-dioctylhexadecyl(dioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | 8,8-dioctylhexadecyl(dioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 175892491 |
| Molecular Formula | C72H100BF20N |
| Molecular Weight | 1370.37 g/mol |
| Exact Mass | 1369.76 |
| IUPAC Name | 8,8-dioctylhexadecyl(dioctyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCCCCCCC[NH+](CCCCCCCC)CCCCCCCC(CCCCCCCC)(CCCCCCCC)CCCCCCCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C48H99N.C24BF20/c1-6-11-16-21-27-34-41-48(42-35-28-22-17-12-7-2,43-36-29-23-18-13-8-3)44-37-30-26-33-40-47-49(45-38-31-24-19-14-9-4)46-39-32-25-20-15-10-5;26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33/h6-47H2,1-5H3;/q;-1/p+1 |
| InChIKey | QWEHXTFTWORLOL-UHFFFAOYSA-O |
| XLogP | 22.02 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 47 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1370.37 |
| LogP ≤ 5 | 22.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|