C9H6F13NO4S2 — CID 175898099
N-(ethenylsulfonylmethyl)-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide (PubChem CID 175898099) has the molecular formula C9H6F13NO4S2 and a molecular weight of 503.26 g/mol. Its IUPAC name is N-(ethenylsulfonylmethyl)-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide.
| Compound Name | N-(ethenylsulfonylmethyl)-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide |
|---|---|
| PubChem CID | 175898099 |
| Molecular Formula | C9H6F13NO4S2 |
| Molecular Weight | 503.26 g/mol |
| Exact Mass | 502.95 |
| IUPAC Name | N-(ethenylsulfonylmethyl)-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexane-1-sulfonamide |
| SMILES | C=CS(=O)(=O)CNS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F13NO4S2/c1-2-28(24,25)3-23-29(26,27)9(21,22)7(16,17)5(12,13)4(10,11)6(14,15)8(18,19)20/h2,23H,1,3H2 |
| InChIKey | WGEYRCGWAWWSQB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|