C22H25FN4O6 — CID 175899581
[4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-7-fluoro-1,3-dioxoisoindol-5-yl] piperazine-1-carboxylate (PubChem CID 175899581) has the molecular formula C22H25FN4O6 and a molecular weight of 460.46 g/mol. Its IUPAC name is [4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-7-fluoro-1,3-dioxoisoindol-5-yl] piperazine-1-carboxylate.
| Compound Name | [4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-7-fluoro-1,3-dioxoisoindol-5-yl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175899581 |
| Molecular Formula | C22H25FN4O6 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | [4-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-7-fluoro-1,3-dioxoisoindol-5-yl] piperazine-1-carboxylate |
| SMILES | CC(C)(C)c1c(OC(=O)N2CCNCC2)cc(F)c2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C22H25FN4O6/c1-22(2,3)17-13(33-21(32)26-8-6-24-7-9-26)10-11(23)15-16(17)20(31)27(19(15)30)12-4-5-14(28)25-18(12)29/h10,12,24H,4-9H2,1-3H3,(H,25,28,29) |
| InChIKey | PYOMVRQTZBZQBZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|