C16H21ClN4O4 — CID 175900965
5-(1,4-diazepan-1-yl)-2-(1,3,2-dioxazinan-4-yl)isoindole-1,3-dione;hydrochloride (PubChem CID 175900965) has the molecular formula C16H21ClN4O4 and a molecular weight of 368.82 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-2-(1,3,2-dioxazinan-4-yl)isoindole-1,3-dione;hydrochloride.
| Compound Name | 5-(1,4-diazepan-1-yl)-2-(1,3,2-dioxazinan-4-yl)isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 175900965 |
| Molecular Formula | C16H21ClN4O4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-2-(1,3,2-dioxazinan-4-yl)isoindole-1,3-dione;hydrochloride |
| SMILES | Cl.O=C1c2ccc(N3CCCNCC3)cc2C(=O)N1C1CCONO1 |
| InChI | InChI=1S/C16H20N4O4.ClH/c21-15-12-3-2-11(19-7-1-5-17-6-8-19)10-13(12)16(22)20(15)14-4-9-23-18-24-14;/h2-3,10,14,17-18H,1,4-9H2;1H |
| InChIKey | KLRBLHCGJNREBC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|