C28H37N3O2 — CID 175904266
4-N-heptan-4-yl-2-N,2-N-bis[(4-methoxyphenyl)methyl]pyridine-2,4-diamine (PubChem CID 175904266) has the molecular formula C28H37N3O2 and a molecular weight of 447.62 g/mol. Its IUPAC name is 4-N-heptan-4-yl-2-N,2-N-bis[(4-methoxyphenyl)methyl]pyridine-2,4-diamine.
| Compound Name | 4-N-heptan-4-yl-2-N,2-N-bis[(4-methoxyphenyl)methyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 175904266 |
| Molecular Formula | C28H37N3O2 |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.29 |
| IUPAC Name | 4-N-heptan-4-yl-2-N,2-N-bis[(4-methoxyphenyl)methyl]pyridine-2,4-diamine |
| SMILES | CCCC(CCC)Nc1ccnc(N(Cc2ccc(OC)cc2)Cc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C28H37N3O2/c1-5-7-24(8-6-2)30-25-17-18-29-28(19-25)31(20-22-9-13-26(32-3)14-10-22)21-23-11-15-27(33-4)16-12-23/h9-19,24H,5-8,20-21H2,1-4H3,(H,29,30) |
| InChIKey | FULOAEPKWDNMTQ-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |