C19H23NORu — CID 175907003
2-[2,6-di(propan-2-yl)benzenecarboximidoyl]phenol;ruthenium (PubChem CID 175907003) has the molecular formula C19H23NORu and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[2,6-di(propan-2-yl)benzenecarboximidoyl]phenol;ruthenium.
| Compound Name | 2-[2,6-di(propan-2-yl)benzenecarboximidoyl]phenol;ruthenium |
|---|---|
| PubChem CID | 175907003 |
| Molecular Formula | C19H23NORu |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 2-[2,6-di(propan-2-yl)benzenecarboximidoyl]phenol;ruthenium |
| SMILES | [H]/N=C(\c1ccccc1O)c1c(C(C)C)cccc1C(C)C.[Ru] |
| InChI | InChI=1S/C19H23NO.Ru/c1-12(2)14-9-7-10-15(13(3)4)18(14)19(20)16-8-5-6-11-17(16)21;/h5-13,20-21H,1-4H3;/b20-19+; |
| InChIKey | MWMLCGUEXZQZJJ-RZLHGTIFSA-N |
| XLogP | 5.05 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|