C24H20FN3O5 — CID 175908278
2-fluoro-5-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxy-4-phenylpyridine-3-carboxamide (PubChem CID 175908278) has the molecular formula C24H20FN3O5 and a molecular weight of 449.44 g/mol. Its IUPAC name is 2-fluoro-5-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxy-4-phenylpyridine-3-carboxamide.
| Compound Name | 2-fluoro-5-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxy-4-phenylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 175908278 |
| Molecular Formula | C24H20FN3O5 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 2-fluoro-5-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxy-4-phenylpyridine-3-carboxamide |
| SMILES | COc1cc2c(Oc3cnc(F)c(C(N)=O)c3-c3ccccc3)ccnc2cc1OCCO |
| InChI | InChI=1S/C24H20FN3O5/c1-31-18-11-15-16(12-19(18)32-10-9-29)27-8-7-17(15)33-20-13-28-23(25)22(24(26)30)21(20)14-5-3-2-4-6-14/h2-8,11-13,29H,9-10H2,1H3,(H2,26,30) |
| InChIKey | HZRWMMRCDSWMOL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 116.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|