C31H33FN4O5S — CID 87306234
bicyclo[3.1.0]hexa-1(6),2,4-triene;S-[N-carbamoyl-4-[7-[2-(diethylamino)ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluoroanilino] ethanethioate (PubChem CID 87306234) has the molecular formula C31H33FN4O5S and a molecular weight of 592.69 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;S-[N-carbamoyl-4-[7-[2-(diethylamino)ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluoroanilino] ethanethioate.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;S-[N-carbamoyl-4-[7-[2-(diethylamino)ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluoroanilino] ethanethioate |
|---|---|
| PubChem CID | 87306234 |
| Molecular Formula | C31H33FN4O5S |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;S-[N-carbamoyl-4-[7-[2-(diethylamino)ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluoroanilino] ethanethioate |
| SMILES | CCN(CC)CCOc1cc2nccc(Oc3ccc(N(SC(C)=O)C(N)=O)cc3F)c2cc1OC.c1cc2cc-2c1 |
| InChI | InChI=1S/C25H29FN4O5S.C6H4/c1-5-29(6-2)11-12-34-24-15-20-18(14-23(24)33-4)21(9-10-28-20)35-22-8-7-17(13-19(22)26)30(25(27)32)36-16(3)31;1-2-5-4-6(5)3-1/h7-10,13-15H,5-6,11-12H2,1-4H3,(H2,27,32);1-4H |
| InChIKey | ZIDJVNJQJNWHIF-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|