C26H25F2N3O6 — CID 168942983
(E,2E)-N-[3,5-difluoro-4-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-methoxy-2-[(methylideneamino)methylidene]pent-3-enamide (PubChem CID 168942983) has the molecular formula C26H25F2N3O6 and a molecular weight of 513.50 g/mol. Its IUPAC name is (E,2E)-N-[3,5-difluoro-4-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-methoxy-2-[(methylideneamino)methylidene]pent-3-enamide.
| Compound Name | (E,2E)-N-[3,5-difluoro-4-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-methoxy-2-[(methylideneamino)methylidene]pent-3-enamide |
|---|---|
| PubChem CID | 168942983 |
| Molecular Formula | C26H25F2N3O6 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | (E,2E)-N-[3,5-difluoro-4-[7-(2-hydroxyethoxy)-6-methoxyquinolin-4-yl]oxyphenyl]-3-methoxy-2-[(methylideneamino)methylidene]pent-3-enamide |
| SMILES | C=N/C=C(C(=O)Nc1cc(F)c(Oc2ccnc3cc(OCCO)c(OC)cc23)c(F)c1)\C(=C/C)OC |
| InChI | InChI=1S/C26H25F2N3O6/c1-5-21(34-3)17(14-29-2)26(33)31-15-10-18(27)25(19(28)11-15)37-22-6-7-30-20-13-24(36-9-8-32)23(35-4)12-16(20)22/h5-7,10-14,32H,2,8-9H2,1,3-4H3,(H,31,33)/b17-14+,21-5+ |
| InChIKey | FERSZFVQXDNPKH-RWYKNCLLSA-N |
| XLogP | 4.76 |
| TPSA | 111.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|