C27H24F3N3O5 — CID 175913576
4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-oxo-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]butanamide (PubChem CID 175913576) has the molecular formula C27H24F3N3O5 and a molecular weight of 527.50 g/mol. Its IUPAC name is 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-oxo-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]butanamide.
| Compound Name | 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-oxo-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]butanamide |
|---|---|
| PubChem CID | 175913576 |
| Molecular Formula | C27H24F3N3O5 |
| Molecular Weight | 527.50 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-2-oxo-3-[4-[1-(trifluoromethyl)cyclopropyl]phenyl]butanamide |
| SMILES | NC(=O)C(=O)C(Cc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O)c1ccc(C2(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C27H24F3N3O5/c28-27(29,30)26(9-10-26)17-4-2-15(3-5-17)19(22(35)23(31)36)12-14-1-6-18-16(11-14)13-33(25(18)38)20-7-8-21(34)32-24(20)37/h1-6,11,19-20H,7-10,12-13H2,(H2,31,36)(H,32,34,37) |
| InChIKey | JUEGLMSBVCZLDS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|