C17H20O5S — CID 175915104
5-benzylidene-1,7,7-trimethylbicyclo[2.2.1]hept-3-en-2-one;sulfuric acid (PubChem CID 175915104) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is 5-benzylidene-1,7,7-trimethylbicyclo[2.2.1]hept-3-en-2-one;sulfuric acid.
| Compound Name | 5-benzylidene-1,7,7-trimethylbicyclo[2.2.1]hept-3-en-2-one;sulfuric acid |
|---|---|
| PubChem CID | 175915104 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-benzylidene-1,7,7-trimethylbicyclo[2.2.1]hept-3-en-2-one;sulfuric acid |
| SMILES | CC1(C)C2=CC(=O)C1(C)CC2=Cc1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C17H18O.H2O4S/c1-16(2)14-10-15(18)17(16,3)11-13(14)9-12-7-5-4-6-8-12;1-5(2,3)4/h4-10H,11H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | VYFFZHFOACGNKA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|