C7H10Cl2N4O — CID 175915186
5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;dihydrochloride (PubChem CID 175915186) has the molecular formula C7H10Cl2N4O and a molecular weight of 237.09 g/mol. Its IUPAC name is 5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;dihydrochloride.
| Compound Name | 5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 175915186 |
| Molecular Formula | C7H10Cl2N4O |
| Molecular Weight | 237.09 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 5-ethynyl-3-(methylamino)-1H-pyrazole-4-carboxamide;dihydrochloride |
| SMILES | C#Cc1[nH]nc(NC)c1C(N)=O.Cl.Cl |
| InChI | InChI=1S/C7H8N4O.2ClH/c1-3-4-5(6(8)12)7(9-2)11-10-4;;/h1H,2H3,(H2,8,12)(H2,9,10,11);2*1H |
| InChIKey | UDFHYENUNVUMHN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.09 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|