C24H16N4O7 — CID 175916631
4-[3-[(1,4-dioxonaphthalen-2-yl)amino]phenyl]-2-methyl-3,5-dinitrobenzamide (PubChem CID 175916631) has the molecular formula C24H16N4O7 and a molecular weight of 472.41 g/mol. Its IUPAC name is 4-[3-[(1,4-dioxonaphthalen-2-yl)amino]phenyl]-2-methyl-3,5-dinitrobenzamide.
| Compound Name | 4-[3-[(1,4-dioxonaphthalen-2-yl)amino]phenyl]-2-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 175916631 |
| Molecular Formula | C24H16N4O7 |
| Molecular Weight | 472.41 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | 4-[3-[(1,4-dioxonaphthalen-2-yl)amino]phenyl]-2-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c(C(N)=O)cc([N+](=O)[O-])c(-c2cccc(NC3=CC(=O)c4ccccc4C3=O)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H16N4O7/c1-12-17(24(25)31)10-19(27(32)33)21(22(12)28(34)35)13-5-4-6-14(9-13)26-18-11-20(29)15-7-2-3-8-16(15)23(18)30/h2-11,26H,1H3,(H2,25,31) |
| InChIKey | JTFFIBFGQVGSAA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 175.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|