C15H25Ir+2 — CID 175918734
iridium(3+);1,2,3,4,5-pentaethylcyclopenta-1,3-diene (PubChem CID 175918734) has the molecular formula C15H25Ir+2 and a molecular weight of 397.58 g/mol. Its IUPAC name is iridium(3+);1,2,3,4,5-pentaethylcyclopenta-1,3-diene.
| Compound Name | iridium(3+);1,2,3,4,5-pentaethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 175918734 |
| Molecular Formula | C15H25Ir+2 |
| Molecular Weight | 397.58 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | iridium(3+);1,2,3,4,5-pentaethylcyclopenta-1,3-diene |
| SMILES | CCc1c(CC)c(CC)[c-](CC)c1CC.[Ir+3] |
| InChI | InChI=1S/C15H25.Ir/c1-6-11-12(7-2)14(9-4)15(10-5)13(11)8-3;/h6-10H2,1-5H3;/q-1;+3 |
| InChIKey | KVPCIBMJCKHPAU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|