C28H33N5O3 — CID 175920534
N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine (PubChem CID 175920534) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 175920534 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-6-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine |
| SMILES | CCN1CCN(c2ccc(Nc3n[nH]c4cc(-c5cc(OC)c(OC)c(OC)c5)ccc34)cc2)CC1 |
| InChI | InChI=1S/C28H33N5O3/c1-5-32-12-14-33(15-13-32)22-9-7-21(8-10-22)29-28-23-11-6-19(16-24(23)30-31-28)20-17-25(34-2)27(36-4)26(18-20)35-3/h6-11,16-18H,5,12-15H2,1-4H3,(H2,29,30,31) |
| InChIKey | ZEFLRAFOZBXGEA-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 74.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|