C21H27N5 — CID 175921277
6-ethyl-N-phenyl-5-[1-(1H-pyrrol-2-yl)hexyl]triazin-4-amine (PubChem CID 175921277) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is 6-ethyl-N-phenyl-5-[1-(1H-pyrrol-2-yl)hexyl]triazin-4-amine.
| Compound Name | 6-ethyl-N-phenyl-5-[1-(1H-pyrrol-2-yl)hexyl]triazin-4-amine |
|---|---|
| PubChem CID | 175921277 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | 6-ethyl-N-phenyl-5-[1-(1H-pyrrol-2-yl)hexyl]triazin-4-amine |
| SMILES | CCCCCC(c1ccc[nH]1)c1c(CC)nnnc1Nc1ccccc1 |
| InChI | InChI=1S/C21H27N5/c1-3-5-7-13-17(19-14-10-15-22-19)20-18(4-2)24-26-25-21(20)23-16-11-8-6-9-12-16/h6,8-12,14-15,17,22H,3-5,7,13H2,1-2H3,(H,23,24,25) |
| InChIKey | RQTLNCXVCFPCAM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|