C24H26N4O4S — CID 175922699
N-[[3-[[7-ethenyl-8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]phenyl]methylidene]methanesulfonamide (PubChem CID 175922699) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is N-[[3-[[7-ethenyl-8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]phenyl]methylidene]methanesulfonamide.
| Compound Name | N-[[3-[[7-ethenyl-8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]phenyl]methylidene]methanesulfonamide |
|---|---|
| PubChem CID | 175922699 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-[[3-[[7-ethenyl-8-(4-hydroxycyclohexyl)oxyquinazolin-2-yl]amino]phenyl]methylidene]methanesulfonamide |
| SMILES | C=Cc1ccc2cnc(Nc3cccc(C=NS(C)(=O)=O)c3)nc2c1OC1CCC(O)CC1 |
| InChI | InChI=1S/C24H26N4O4S/c1-3-17-7-8-18-15-25-24(27-19-6-4-5-16(13-19)14-26-33(2,30)31)28-22(18)23(17)32-21-11-9-20(29)10-12-21/h3-8,13-15,20-21,29H,1,9-12H2,2H3,(H,25,27,28) |
| InChIKey | SVFBTJZQBUMGDB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|