C22H24FN5O3 — CID 167157939
4-[2-[3-amino-4-(2-hydroxyethanimidoyl)anilino]-7-fluoroquinazolin-8-yl]oxycyclohexan-1-ol (PubChem CID 167157939) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is 4-[2-[3-amino-4-(2-hydroxyethanimidoyl)anilino]-7-fluoroquinazolin-8-yl]oxycyclohexan-1-ol.
| Compound Name | 4-[2-[3-amino-4-(2-hydroxyethanimidoyl)anilino]-7-fluoroquinazolin-8-yl]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 167157939 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 4-[2-[3-amino-4-(2-hydroxyethanimidoyl)anilino]-7-fluoroquinazolin-8-yl]oxycyclohexan-1-ol |
| SMILES | [H]/N=C(\CO)c1ccc(Nc2ncc3ccc(F)c(OC4CCC(O)CC4)c3n2)cc1N |
| InChI | InChI=1S/C22H24FN5O3/c23-17-8-1-12-10-26-22(27-13-2-7-16(18(24)9-13)19(25)11-29)28-20(12)21(17)31-15-5-3-14(30)4-6-15/h1-2,7-10,14-15,25,29-30H,3-6,11,24H2,(H,26,27,28)/b25-19+ |
| InChIKey | VRMXZYMISCEQSW-NCELDCMTSA-N |
| XLogP | 3.14 |
| TPSA | 137.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|