C28H27NO8 — CID 175924458
1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-nitrophenyl)methylidene]heptane-3,5-dione (PubChem CID 175924458) has the molecular formula C28H27NO8 and a molecular weight of 505.52 g/mol. Its IUPAC name is 1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-nitrophenyl)methylidene]heptane-3,5-dione.
| Compound Name | 1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-nitrophenyl)methylidene]heptane-3,5-dione |
|---|---|
| PubChem CID | 175924458 |
| Molecular Formula | C28H27NO8 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 1,7-bis(4-hydroxy-3-methoxyphenyl)-4-[(4-nitrophenyl)methylidene]heptane-3,5-dione |
| SMILES | COc1cc(CCC(=O)C(=Cc2ccc([N+](=O)[O-])cc2)C(=O)CCc2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C28H27NO8/c1-36-27-16-19(7-13-25(27)32)5-11-23(30)22(15-18-3-9-21(10-4-18)29(34)35)24(31)12-6-20-8-14-26(33)28(17-20)37-2/h3-4,7-10,13-17,32-33H,5-6,11-12H2,1-2H3 |
| InChIKey | NWFQOLWTXIPDCP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|