C17H25F4N5O3Si — CID 175926413
2-[[4-[1-(3-fluoro-4-nitropyrazol-1-yl)propyl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 175926413) has the molecular formula C17H25F4N5O3Si and a molecular weight of 451.50 g/mol. Its IUPAC name is 2-[[4-[1-(3-fluoro-4-nitropyrazol-1-yl)propyl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[4-[1-(3-fluoro-4-nitropyrazol-1-yl)propyl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 175926413 |
| Molecular Formula | C17H25F4N5O3Si |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 2-[[4-[1-(3-fluoro-4-nitropyrazol-1-yl)propyl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCC(c1cn(COCC[Si](C)(C)C)nc1CC(F)(F)F)n1cc([N+](=O)[O-])c(F)n1 |
| InChI | InChI=1S/C17H25F4N5O3Si/c1-5-14(25-10-15(26(27)28)16(18)23-25)12-9-24(11-29-6-7-30(2,3)4)22-13(12)8-17(19,20)21/h9-10,14H,5-8,11H2,1-4H3 |
| InChIKey | JRVHOULPPPUYHI-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 88.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|