C25H28ClFN4O2 — CID 175938166
2-[1-(3-chloro-4-fluoroanilino)-5-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide (PubChem CID 175938166) has the molecular formula C25H28ClFN4O2 and a molecular weight of 470.98 g/mol. Its IUPAC name is 2-[1-(3-chloro-4-fluoroanilino)-5-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide.
| Compound Name | 2-[1-(3-chloro-4-fluoroanilino)-5-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide |
|---|---|
| PubChem CID | 175938166 |
| Molecular Formula | C25H28ClFN4O2 |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 2-[1-(3-chloro-4-fluoroanilino)-5-methoxyisoquinolin-7-yl]-4-piperidin-1-ylbutanamide |
| SMILES | COc1cc(C(CCN2CCCCC2)C(N)=O)cc2c(Nc3ccc(F)c(Cl)c3)nccc12 |
| InChI | InChI=1S/C25H28ClFN4O2/c1-33-23-14-16(18(24(28)32)8-12-31-10-3-2-4-11-31)13-20-19(23)7-9-29-25(20)30-17-5-6-22(27)21(26)15-17/h5-7,9,13-15,18H,2-4,8,10-12H2,1H3,(H2,28,32)(H,29,30) |
| InChIKey | SSNWZVJAJSALBX-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |