C14H14F2O3 — CID 175942612
2-[[4-(difluoromethoxy)phenyl]methyl]-4-hydroxycyclohex-3-en-1-one (PubChem CID 175942612) has the molecular formula C14H14F2O3 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-[[4-(difluoromethoxy)phenyl]methyl]-4-hydroxycyclohex-3-en-1-one.
| Compound Name | 2-[[4-(difluoromethoxy)phenyl]methyl]-4-hydroxycyclohex-3-en-1-one |
|---|---|
| PubChem CID | 175942612 |
| Molecular Formula | C14H14F2O3 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-[[4-(difluoromethoxy)phenyl]methyl]-4-hydroxycyclohex-3-en-1-one |
| SMILES | O=C1CCC(O)=CC1Cc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C14H14F2O3/c15-14(16)19-12-4-1-9(2-5-12)7-10-8-11(17)3-6-13(10)18/h1-2,4-5,8,10,14,17H,3,6-7H2 |
| InChIKey | XCDNWXMVLXRPEE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |