C36H73N7O3 — CID 175946141
(5S,9S)-1,5,9,13-tetraamino-7-[(Z)-17-aminoheptadec-8-enyl]-7-[(2S)-2,6-diaminohexanoyl]tridecane-6,8-dione (PubChem CID 175946141) has the molecular formula C36H73N7O3 and a molecular weight of 652.03 g/mol. Its IUPAC name is (5S,9S)-1,5,9,13-tetraamino-7-[(Z)-17-aminoheptadec-8-enyl]-7-[(2S)-2,6-diaminohexanoyl]tridecane-6,8-dione.
| Compound Name | (5S,9S)-1,5,9,13-tetraamino-7-[(Z)-17-aminoheptadec-8-enyl]-7-[(2S)-2,6-diaminohexanoyl]tridecane-6,8-dione |
|---|---|
| PubChem CID | 175946141 |
| Molecular Formula | C36H73N7O3 |
| Molecular Weight | 652.03 g/mol |
| Exact Mass | 651.58 |
| IUPAC Name | (5S,9S)-1,5,9,13-tetraamino-7-[(Z)-17-aminoheptadec-8-enyl]-7-[(2S)-2,6-diaminohexanoyl]tridecane-6,8-dione |
| SMILES | NCCCCCCCC/C=C\CCCCCCCC(C(=O)[C@@H](N)CCCCN)(C(=O)[C@@H](N)CCCCN)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C36H73N7O3/c37-26-18-13-11-9-7-5-3-1-2-4-6-8-10-12-17-25-36(33(44)30(41)22-14-19-27-38,34(45)31(42)23-15-20-28-39)35(46)32(43)24-16-21-29-40/h1-2,30-32H,3-29,37-43H2/b2-1-/t30-,31-,32-/m0/s1 |
| InChIKey | CESRYGAODDPMMR-SAOFNNDBSA-N |
| XLogP | 4.03 |
| TPSA | 233.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.03 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|